C18H27BrO3S — CID 122217656
[(3S,5R)-5,9-dimethyldec-8-en-3-yl] 4-bromobenzenesulfonate (PubChem CID 122217656) has the molecular formula C18H27BrO3S and a molecular weight of 403.38 g/mol. Its IUPAC name is [(3S,5R)-5,9-dimethyldec-8-en-3-yl] 4-bromobenzenesulfonate.
| Compound Name | [(3S,5R)-5,9-dimethyldec-8-en-3-yl] 4-bromobenzenesulfonate |
|---|---|
| PubChem CID | 122217656 |
| Molecular Formula | C18H27BrO3S |
| Molecular Weight | 403.38 g/mol |
| Exact Mass | 402.09 |
| IUPAC Name | [(3S,5R)-5,9-dimethyldec-8-en-3-yl] 4-bromobenzenesulfonate |
| SMILES | CC[C@@H](C[C@H](C)CCC=C(C)C)OS(=O)(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C18H27BrO3S/c1-5-17(13-15(4)8-6-7-14(2)3)22-23(20,21)18-11-9-16(19)10-12-18/h7,9-12,15,17H,5-6,8,13H2,1-4H3/t15-,17+/m1/s1 |
| InChIKey | LIBUVQZSXPLZJM-WBVHZDCISA-N |
| XLogP | 5.71 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.38 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|