C18H22O6S2 — CID 11112108
2-(4-methylphenyl)sulfonyloxybutyl 4-methylbenzenesulfonate (PubChem CID 11112108) has the molecular formula C18H22O6S2 and a molecular weight of 398.50 g/mol. Its IUPAC name is 2-(4-methylphenyl)sulfonyloxybutyl 4-methylbenzenesulfonate.
| Compound Name | 2-(4-methylphenyl)sulfonyloxybutyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 11112108 |
| Molecular Formula | C18H22O6S2 |
| Molecular Weight | 398.50 g/mol |
| Exact Mass | 398.09 |
| IUPAC Name | 2-(4-methylphenyl)sulfonyloxybutyl 4-methylbenzenesulfonate |
| SMILES | CCC(COS(=O)(=O)c1ccc(C)cc1)OS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C18H22O6S2/c1-4-16(24-26(21,22)18-11-7-15(3)8-12-18)13-23-25(19,20)17-9-5-14(2)6-10-17/h5-12,16H,4,13H2,1-3H3 |
| InChIKey | LACPJBJAWXHWPB-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.50 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|