C16H24O5S — CID 118137670
1-(4-methylphenyl)sulfonyloxybutan-2-yl pentanoate (PubChem CID 118137670) has the molecular formula C16H24O5S and a molecular weight of 328.43 g/mol. Its IUPAC name is 1-(4-methylphenyl)sulfonyloxybutan-2-yl pentanoate.
| Compound Name | 1-(4-methylphenyl)sulfonyloxybutan-2-yl pentanoate |
|---|---|
| PubChem CID | 118137670 |
| Molecular Formula | C16H24O5S |
| Molecular Weight | 328.43 g/mol |
| Exact Mass | 328.13 |
| IUPAC Name | 1-(4-methylphenyl)sulfonyloxybutan-2-yl pentanoate |
| SMILES | CCCCC(=O)OC(CC)COS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C16H24O5S/c1-4-6-7-16(17)21-14(5-2)12-20-22(18,19)15-10-8-13(3)9-11-15/h8-11,14H,4-7,12H2,1-3H3 |
| InChIKey | FTNTVMQBPPVINE-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.43 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|