C14H22O4S3 — CID 24812666
[3,3-bis(ethylsulfanyl)-2-hydroxypropyl] 4-methylbenzenesulfonate (PubChem CID 24812666) has the molecular formula C14H22O4S3 and a molecular weight of 350.53 g/mol. Its IUPAC name is [3,3-bis(ethylsulfanyl)-2-hydroxypropyl] 4-methylbenzenesulfonate.
| Compound Name | [3,3-bis(ethylsulfanyl)-2-hydroxypropyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 24812666 |
| Molecular Formula | C14H22O4S3 |
| Molecular Weight | 350.53 g/mol |
| Exact Mass | 350.07 |
| IUPAC Name | [3,3-bis(ethylsulfanyl)-2-hydroxypropyl] 4-methylbenzenesulfonate |
| SMILES | CCSC(SCC)C(O)COS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C14H22O4S3/c1-4-19-14(20-5-2)13(15)10-18-21(16,17)12-8-6-11(3)7-9-12/h6-9,13-15H,4-5,10H2,1-3H3 |
| InChIKey | GSQBSDPLRCTTIB-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.53 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|