C12H18O5S — CID 11000254
[(2R)-2,3-dihydroxy-3-methylbutyl] 4-methylbenzenesulfonate (PubChem CID 11000254) has the molecular formula C12H18O5S and a molecular weight of 274.34 g/mol. Its IUPAC name is [(2R)-2,3-dihydroxy-3-methylbutyl] 4-methylbenzenesulfonate.
| Compound Name | [(2R)-2,3-dihydroxy-3-methylbutyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 11000254 |
| Molecular Formula | C12H18O5S |
| Molecular Weight | 274.34 g/mol |
| Exact Mass | 274.09 |
| IUPAC Name | [(2R)-2,3-dihydroxy-3-methylbutyl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC[C@@H](O)C(C)(C)O)cc1 |
| InChI | InChI=1S/C12H18O5S/c1-9-4-6-10(7-5-9)18(15,16)17-8-11(13)12(2,3)14/h4-7,11,13-14H,8H2,1-3H3/t11-/m1/s1 |
| InChIKey | QAAVLHVZKTUTCM-LLVKDONJSA-N |
| XLogP | 0.83 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.34 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|