C17H26O6S — CID 10021322
[(2S,3S)-3-[(3R)-3,4-dihydroxy-4-methylpentyl]-3-methyloxiran-2-yl]methyl 4-methylbenzenesulfonate (PubChem CID 10021322) has the molecular formula C17H26O6S and a molecular weight of 358.46 g/mol. Its IUPAC name is [(2S,3S)-3-[(3R)-3,4-dihydroxy-4-methylpentyl]-3-methyloxiran-2-yl]methyl 4-methylbenzenesulfonate.
| Compound Name | [(2S,3S)-3-[(3R)-3,4-dihydroxy-4-methylpentyl]-3-methyloxiran-2-yl]methyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 10021322 |
| Molecular Formula | C17H26O6S |
| Molecular Weight | 358.46 g/mol |
| Exact Mass | 358.15 |
| IUPAC Name | [(2S,3S)-3-[(3R)-3,4-dihydroxy-4-methylpentyl]-3-methyloxiran-2-yl]methyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC[C@@H]2O[C@@]2(C)CC[C@@H](O)C(C)(C)O)cc1 |
| InChI | InChI=1S/C17H26O6S/c1-12-5-7-13(8-6-12)24(20,21)22-11-15-17(4,23-15)10-9-14(18)16(2,3)19/h5-8,14-15,18-19H,9-11H2,1-4H3/t14-,15+,17+/m1/s1 |
| InChIKey | SDIZYUUMACLOHW-VYDXJSESSA-N |
| XLogP | 1.77 |
| TPSA | 96.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.46 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|