C17H28O5S — CID 101457111
(6,7-dihydroxy-3,7-dimethyloctyl) 4-methylbenzenesulfonate (PubChem CID 101457111) has the molecular formula C17H28O5S and a molecular weight of 344.47 g/mol. Its IUPAC name is (6,7-dihydroxy-3,7-dimethyloctyl) 4-methylbenzenesulfonate.
| Compound Name | (6,7-dihydroxy-3,7-dimethyloctyl) 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 101457111 |
| Molecular Formula | C17H28O5S |
| Molecular Weight | 344.47 g/mol |
| Exact Mass | 344.17 |
| IUPAC Name | (6,7-dihydroxy-3,7-dimethyloctyl) 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCCC(C)CCC(O)C(C)(C)O)cc1 |
| InChI | InChI=1S/C17H28O5S/c1-13-5-8-15(9-6-13)23(20,21)22-12-11-14(2)7-10-16(18)17(3,4)19/h5-6,8-9,14,16,18-19H,7,10-12H2,1-4H3 |
| InChIKey | NRXYOZSXHKUTPA-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.47 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|