C12H16O4S — CID 132553821
[(3R)-3-hydroxypent-4-enyl] 4-methylbenzenesulfonate (PubChem CID 132553821) has the molecular formula C12H16O4S and a molecular weight of 256.32 g/mol. Its IUPAC name is [(3R)-3-hydroxypent-4-enyl] 4-methylbenzenesulfonate.
| Compound Name | [(3R)-3-hydroxypent-4-enyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 132553821 |
| Molecular Formula | C12H16O4S |
| Molecular Weight | 256.32 g/mol |
| Exact Mass | 256.08 |
| IUPAC Name | [(3R)-3-hydroxypent-4-enyl] 4-methylbenzenesulfonate |
| SMILES | C=C[C@H](O)CCOS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C12H16O4S/c1-3-11(13)8-9-16-17(14,15)12-6-4-10(2)5-7-12/h3-7,11,13H,1,8-9H2,2H3/t11-/m0/s1 |
| InChIKey | IMOXHPJENZGKGR-NSHDSACASA-N |
| XLogP | 1.64 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.32 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|