C22H26O6S2 — CID 15321034
[3,4-dimethylidene-6-(4-methylphenyl)sulfonyloxyhexyl] 4-methylbenzenesulfonate (PubChem CID 15321034) has the molecular formula C22H26O6S2 and a molecular weight of 450.58 g/mol. Its IUPAC name is [3,4-dimethylidene-6-(4-methylphenyl)sulfonyloxyhexyl] 4-methylbenzenesulfonate.
| Compound Name | [3,4-dimethylidene-6-(4-methylphenyl)sulfonyloxyhexyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 15321034 |
| Molecular Formula | C22H26O6S2 |
| Molecular Weight | 450.58 g/mol |
| Exact Mass | 450.12 |
| IUPAC Name | [3,4-dimethylidene-6-(4-methylphenyl)sulfonyloxyhexyl] 4-methylbenzenesulfonate |
| SMILES | C=C(CCOS(=O)(=O)c1ccc(C)cc1)C(=C)CCOS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C22H26O6S2/c1-17-5-9-21(10-6-17)29(23,24)27-15-13-19(3)20(4)14-16-28-30(25,26)22-11-7-18(2)8-12-22/h5-12H,3-4,13-16H2,1-2H3 |
| InChIKey | WWSXNMBNCNXNKS-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.58 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|