About 4-oxopentyl 4-methylbenzenesulfonate
4-oxopentyl 4-methylbenzenesulfonate (PubChem CID 12570315) has the molecular formula C12H16O4S
and a molecular weight of 256.32 g/mol. Its IUPAC name is 4-oxopentyl 4-methylbenzenesulfonate.
Molecular Properties
| Compound Name | 4-oxopentyl 4-methylbenzenesulfonate |
| PubChem CID | 12570315 |
| Molecular Formula | C12H16O4S |
| Molecular Weight | 256.32 g/mol |
| Exact Mass | 256.08 |
| IUPAC Name | 4-oxopentyl 4-methylbenzenesulfonate |
| SMILES | CC(=O)CCCOS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C12H16O4S/c1-10-5-7-12(8-6-10)17(14,15)16-9-3-4-11(2)13/h5-8H,3-4,9H2,1-2H3 |
| InChIKey | QCHBQBKLOCGNQX-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.32 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze 4-oxopentyl 4-methylbenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-oxopentyl 4-methylbenzenesulfonate?
The IUPAC name of 4-oxopentyl 4-methylbenzenesulfonate (CID 12570315) is 4-oxopentyl 4-methylbenzenesulfonate.
What is the SMILES notation for 4-oxopentyl 4-methylbenzenesulfonate?
The canonical SMILES for 4-oxopentyl 4-methylbenzenesulfonate is CC(=O)CCCOS(=O)(=O)c1ccc(C)cc1.
What is the InChIKey of 4-oxopentyl 4-methylbenzenesulfonate?
The InChIKey is QCHBQBKLOCGNQX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16O4S/c1-10-5-7-12(8-6-10)17(14,15)16-9-3-4-11(2)13/h5-8H,3-4,9H2,1-2H3.
What are the key properties of 4-oxopentyl 4-methylbenzenesulfonate?
4-oxopentyl 4-methylbenzenesulfonate has a molecular weight of 256.32 g/mol, XLogP of 2.07, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-oxopentyl 4-methylbenzenesulfonate is sourced from PubChem (CID 12570315), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).