C18H19O5S2- — CID 57003197
1-(4-ethenylphenyl)-3-(4-methylphenyl)sulfonyloxypropane-1-sulfinate (PubChem CID 57003197) has the molecular formula C18H19O5S2- and a molecular weight of 379.48 g/mol. Its IUPAC name is 1-(4-ethenylphenyl)-3-(4-methylphenyl)sulfonyloxypropane-1-sulfinate.
| Compound Name | 1-(4-ethenylphenyl)-3-(4-methylphenyl)sulfonyloxypropane-1-sulfinate |
|---|---|
| PubChem CID | 57003197 |
| Molecular Formula | C18H19O5S2- |
| Molecular Weight | 379.48 g/mol |
| Exact Mass | 379.07 |
| IUPAC Name | 1-(4-ethenylphenyl)-3-(4-methylphenyl)sulfonyloxypropane-1-sulfinate |
| SMILES | C=Cc1ccc(C(CCOS(=O)(=O)c2ccc(C)cc2)S(=O)[O-])cc1 |
| InChI | InChI=1S/C18H20O5S2/c1-3-15-6-8-16(9-7-15)18(24(19)20)12-13-23-25(21,22)17-10-4-14(2)5-11-17/h3-11,18H,1,12-13H2,2H3,(H,19,20)/p-1 |
| InChIKey | CDIQFUARBBNABB-UHFFFAOYSA-M |
| XLogP | 3.35 |
| TPSA | 83.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.48 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|