About 4-ethenoxybutyl 4-ethenylbenzenesulfonate
4-ethenoxybutyl 4-ethenylbenzenesulfonate (PubChem CID 20697219) has the molecular formula C14H18O4S
and a molecular weight of 282.36 g/mol. Its IUPAC name is 4-ethenoxybutyl 4-ethenylbenzenesulfonate.
Molecular Properties
| Compound Name | 4-ethenoxybutyl 4-ethenylbenzenesulfonate |
| PubChem CID | 20697219 |
| Molecular Formula | C14H18O4S |
| Molecular Weight | 282.36 g/mol |
| Exact Mass | 282.09 |
| IUPAC Name | 4-ethenoxybutyl 4-ethenylbenzenesulfonate |
| SMILES | C=COCCCCOS(=O)(=O)c1ccc(C=C)cc1 |
| InChI | InChI=1S/C14H18O4S/c1-3-13-7-9-14(10-8-13)19(15,16)18-12-6-5-11-17-4-2/h3-4,7-10H,1-2,5-6,11-12H2 |
| InChIKey | FSWOLNHDJZFHGT-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.36 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze 4-ethenoxybutyl 4-ethenylbenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethenoxybutyl 4-ethenylbenzenesulfonate?
The IUPAC name of 4-ethenoxybutyl 4-ethenylbenzenesulfonate (CID 20697219) is 4-ethenoxybutyl 4-ethenylbenzenesulfonate.
What is the SMILES notation for 4-ethenoxybutyl 4-ethenylbenzenesulfonate?
The canonical SMILES for 4-ethenoxybutyl 4-ethenylbenzenesulfonate is C=COCCCCOS(=O)(=O)c1ccc(C=C)cc1.
What is the InChIKey of 4-ethenoxybutyl 4-ethenylbenzenesulfonate?
The InChIKey is FSWOLNHDJZFHGT-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18O4S/c1-3-13-7-9-14(10-8-13)19(15,16)18-12-6-5-11-17-4-2/h3-4,7-10H,1-2,5-6,11-12H2.
What are the key properties of 4-ethenoxybutyl 4-ethenylbenzenesulfonate?
4-ethenoxybutyl 4-ethenylbenzenesulfonate has a molecular weight of 282.36 g/mol, XLogP of 2.98, 9 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethenoxybutyl 4-ethenylbenzenesulfonate is sourced from PubChem (CID 20697219), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).