C20H23O5S- — CID 140670040
4-[6-(4-ethenylphenoxy)hexoxy]benzenesulfonate (PubChem CID 140670040) has the molecular formula C20H23O5S- and a molecular weight of 375.47 g/mol. Its IUPAC name is 4-[6-(4-ethenylphenoxy)hexoxy]benzenesulfonate.
| Compound Name | 4-[6-(4-ethenylphenoxy)hexoxy]benzenesulfonate |
|---|---|
| PubChem CID | 140670040 |
| Molecular Formula | C20H23O5S- |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.13 |
| IUPAC Name | 4-[6-(4-ethenylphenoxy)hexoxy]benzenesulfonate |
| SMILES | C=Cc1ccc(OCCCCCCOc2ccc(S(=O)(=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C20H24O5S/c1-2-17-7-9-18(10-8-17)24-15-5-3-4-6-16-25-19-11-13-20(14-12-19)26(21,22)23/h2,7-14H,1,3-6,15-16H2,(H,21,22,23)/p-1 |
| InChIKey | BIFFFTXASYKJLB-UHFFFAOYSA-M |
| XLogP | 4.25 |
| TPSA | 75.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|