C22H28Na2O8S2 — CID 160574785
disodium;4-[10-(4-sulfonatophenoxy)decoxy]benzenesulfonate (PubChem CID 160574785) has the molecular formula C22H28Na2O8S2 and a molecular weight of 530.57 g/mol. Its IUPAC name is disodium;4-[10-(4-sulfonatophenoxy)decoxy]benzenesulfonate.
| Compound Name | disodium;4-[10-(4-sulfonatophenoxy)decoxy]benzenesulfonate |
|---|---|
| PubChem CID | 160574785 |
| Molecular Formula | C22H28Na2O8S2 |
| Molecular Weight | 530.57 g/mol |
| Exact Mass | 530.10 |
| IUPAC Name | disodium;4-[10-(4-sulfonatophenoxy)decoxy]benzenesulfonate |
| SMILES | O=S(=O)([O-])c1ccc(OCCCCCCCCCCOc2ccc(S(=O)(=O)[O-])cc2)cc1.[Na+].[Na+] |
| InChI | InChI=1S/C22H30O8S2.2Na/c23-31(24,25)21-13-9-19(10-14-21)29-17-7-5-3-1-2-4-6-8-18-30-20-11-15-22(16-12-20)32(26,27)28;;/h9-16H,1-8,17-18H2,(H,23,24,25)(H,26,27,28);;/q;2*+1/p-2 |
| InChIKey | RAZUFUBNKWWFMO-UHFFFAOYSA-L |
| XLogP | -1.92 |
| TPSA | 132.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.57 |
| LogP ≤ 5 | -1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|