C10H14KNO6S2 — CID 59296872
potassium 4-[3-(methanesulfonamido)propoxy]benzenesulfonate (PubChem CID 59296872) has the molecular formula C10H14KNO6S2 and a molecular weight of 347.46 g/mol. Its IUPAC name is potassium 4-[3-(methanesulfonamido)propoxy]benzenesulfonate.
| Compound Name | potassium 4-[3-(methanesulfonamido)propoxy]benzenesulfonate |
|---|---|
| PubChem CID | 59296872 |
| Molecular Formula | C10H14KNO6S2 |
| Molecular Weight | 347.46 g/mol |
| Exact Mass | 346.99 |
| IUPAC Name | potassium 4-[3-(methanesulfonamido)propoxy]benzenesulfonate |
| SMILES | CS(=O)(=O)NCCCOc1ccc(S(=O)(=O)[O-])cc1.[K+] |
| InChI | InChI=1S/C10H15NO6S2.K/c1-18(12,13)11-7-2-8-17-9-3-5-10(6-4-9)19(14,15)16;/h3-6,11H,2,7-8H2,1H3,(H,14,15,16);/q;+1/p-1 |
| InChIKey | FMZQRGNSXUKRKN-UHFFFAOYSA-M |
| XLogP | -3.09 |
| TPSA | 112.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.46 |
| LogP ≤ 5 | -3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|