C37H46O6S2 — CID 162314273
4-methylbenzenesulfonate;tris(4-butoxyphenyl)sulfanium (PubChem CID 162314273) has the molecular formula C37H46O6S2 and a molecular weight of 650.90 g/mol. Its IUPAC name is 4-methylbenzenesulfonate;tris(4-butoxyphenyl)sulfanium.
| Compound Name | 4-methylbenzenesulfonate;tris(4-butoxyphenyl)sulfanium |
|---|---|
| PubChem CID | 162314273 |
| Molecular Formula | C37H46O6S2 |
| Molecular Weight | 650.90 g/mol |
| Exact Mass | 650.27 |
| IUPAC Name | 4-methylbenzenesulfonate;tris(4-butoxyphenyl)sulfanium |
| SMILES | CCCCOc1ccc([S+](c2ccc(OCCCC)cc2)c2ccc(OCCCC)cc2)cc1.Cc1ccc(S(=O)(=O)[O-])cc1 |
| InChI | InChI=1S/C30H39O3S.C7H8O3S/c1-4-7-22-31-25-10-16-28(17-11-25)34(29-18-12-26(13-19-29)32-23-8-5-2)30-20-14-27(15-21-30)33-24-9-6-3;1-6-2-4-7(5-3-6)11(8,9)10/h10-21H,4-9,22-24H2,1-3H3;2-5H,1H3,(H,8,9,10)/q+1;/p-1 |
| InChIKey | NSBKGQKNKJZRSU-UHFFFAOYSA-M |
| XLogP | 9.22 |
| TPSA | 84.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.90 |
| LogP ≤ 5 | 9.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|