C17H30O3S2 — CID 162222255
dimethyl(octyl)sulfanium;4-methylbenzenesulfonate (PubChem CID 162222255) has the molecular formula C17H30O3S2 and a molecular weight of 346.56 g/mol. Its IUPAC name is dimethyl(octyl)sulfanium;4-methylbenzenesulfonate.
| Compound Name | dimethyl(octyl)sulfanium;4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 162222255 |
| Molecular Formula | C17H30O3S2 |
| Molecular Weight | 346.56 g/mol |
| Exact Mass | 346.16 |
| IUPAC Name | dimethyl(octyl)sulfanium;4-methylbenzenesulfonate |
| SMILES | CCCCCCCC[S+](C)C.Cc1ccc(S(=O)(=O)[O-])cc1 |
| InChI | InChI=1S/C10H23S.C7H8O3S/c1-4-5-6-7-8-9-10-11(2)3;1-6-2-4-7(5-3-6)11(8,9)10/h4-10H2,1-3H3;2-5H,1H3,(H,8,9,10)/q+1;/p-1 |
| InChIKey | ZUGXLFKCJOVMMD-UHFFFAOYSA-M |
| XLogP | 4.12 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.56 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|