C21H39NO3S — CID 87092666
4-methylbenzenesulfonate;triethyl(octyl)azanium (PubChem CID 87092666) has the molecular formula C21H39NO3S and a molecular weight of 385.61 g/mol. Its IUPAC name is 4-methylbenzenesulfonate;triethyl(octyl)azanium.
| Compound Name | 4-methylbenzenesulfonate;triethyl(octyl)azanium |
|---|---|
| PubChem CID | 87092666 |
| Molecular Formula | C21H39NO3S |
| Molecular Weight | 385.61 g/mol |
| Exact Mass | 385.27 |
| IUPAC Name | 4-methylbenzenesulfonate;triethyl(octyl)azanium |
| SMILES | CCCCCCCC[N+](CC)(CC)CC.Cc1ccc(S(=O)(=O)[O-])cc1 |
| InChI | InChI=1S/C14H32N.C7H8O3S/c1-5-9-10-11-12-13-14-15(6-2,7-3)8-4;1-6-2-4-7(5-3-6)11(8,9)10/h5-14H2,1-4H3;2-5H,1H3,(H,8,9,10)/q+1;/p-1 |
| InChIKey | AOMSNMUFSGOQEZ-UHFFFAOYSA-M |
| XLogP | 5.12 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.61 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|