C34H60N2O6S2 — CID 140766321
4-(4-sulfonatophenyl)benzenesulfonate;bis(triethyl(pentyl)azanium) (PubChem CID 140766321) has the molecular formula C34H60N2O6S2 and a molecular weight of 657.00 g/mol. Its IUPAC name is 4-(4-sulfonatophenyl)benzenesulfonate;bis(triethyl(pentyl)azanium).
| Compound Name | 4-(4-sulfonatophenyl)benzenesulfonate;bis(triethyl(pentyl)azanium) |
|---|---|
| PubChem CID | 140766321 |
| Molecular Formula | C34H60N2O6S2 |
| Molecular Weight | 657.00 g/mol |
| Exact Mass | 656.39 |
| IUPAC Name | 4-(4-sulfonatophenyl)benzenesulfonate;bis(triethyl(pentyl)azanium) |
| SMILES | CCCCC[N+](CC)(CC)CC.CCCCC[N+](CC)(CC)CC.O=S(=O)([O-])c1ccc(-c2ccc(S(=O)(=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C12H10O6S2.2C11H26N/c13-19(14,15)11-5-1-9(2-6-11)10-3-7-12(8-4-10)20(16,17)18;2*1-5-9-10-11-12(6-2,7-3)8-4/h1-8H,(H,13,14,15)(H,16,17,18);2*5-11H2,1-4H3/q;2*+1/p-2 |
| InChIKey | VTZDDUIYYBRGDI-UHFFFAOYSA-L |
| XLogP | 7.27 |
| TPSA | 114.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.00 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|