C28H53NO3S — CID 87092532
benzenesulfonate;didecyl(dimethyl)azanium (PubChem CID 87092532) has the molecular formula C28H53NO3S and a molecular weight of 483.80 g/mol. Its IUPAC name is benzenesulfonate;didecyl(dimethyl)azanium.
| Compound Name | benzenesulfonate;didecyl(dimethyl)azanium |
|---|---|
| PubChem CID | 87092532 |
| Molecular Formula | C28H53NO3S |
| Molecular Weight | 483.80 g/mol |
| Exact Mass | 483.37 |
| IUPAC Name | benzenesulfonate;didecyl(dimethyl)azanium |
| SMILES | CCCCCCCCCC[N+](C)(C)CCCCCCCCCC.O=S(=O)([O-])c1ccccc1 |
| InChI | InChI=1S/C22H48N.C6H6O3S/c1-5-7-9-11-13-15-17-19-21-23(3,4)22-20-18-16-14-12-10-8-6-2;7-10(8,9)6-4-2-1-3-5-6/h5-22H2,1-4H3;1-5H,(H,7,8,9)/q+1;/p-1 |
| InChIKey | VGGAIQVBBMBTJR-UHFFFAOYSA-M |
| XLogP | 7.93 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.80 |
| LogP ≤ 5 | 7.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|