C25H37NO3S — CID 161180099
benzenesulfonate;dimethyl-octyl-(2-phenylprop-2-enyl)azanium (PubChem CID 161180099) has the molecular formula C25H37NO3S and a molecular weight of 431.64 g/mol. Its IUPAC name is benzenesulfonate;dimethyl-octyl-(2-phenylprop-2-enyl)azanium.
| Compound Name | benzenesulfonate;dimethyl-octyl-(2-phenylprop-2-enyl)azanium |
|---|---|
| PubChem CID | 161180099 |
| Molecular Formula | C25H37NO3S |
| Molecular Weight | 431.64 g/mol |
| Exact Mass | 431.25 |
| IUPAC Name | benzenesulfonate;dimethyl-octyl-(2-phenylprop-2-enyl)azanium |
| SMILES | C=C(C[N+](C)(C)CCCCCCCC)c1ccccc1.O=S(=O)([O-])c1ccccc1 |
| InChI | InChI=1S/C19H32N.C6H6O3S/c1-5-6-7-8-9-13-16-20(3,4)17-18(2)19-14-11-10-12-15-19;7-10(8,9)6-4-2-1-3-5-6/h10-12,14-15H,2,5-9,13,16-17H2,1,3-4H3;1-5H,(H,7,8,9)/q+1;/p-1 |
| InChIKey | USIIZANJBFARLJ-UHFFFAOYSA-M |
| XLogP | 5.73 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.64 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|