C48H62BN — CID 161058634
diheptyl-methyl-(2-phenylprop-2-enyl)azanium;tetraphenylboranuide (PubChem CID 161058634) has the molecular formula C48H62BN and a molecular weight of 663.84 g/mol. Its IUPAC name is diheptyl-methyl-(2-phenylprop-2-enyl)azanium;tetraphenylboranuide.
| Compound Name | diheptyl-methyl-(2-phenylprop-2-enyl)azanium;tetraphenylboranuide |
|---|---|
| PubChem CID | 161058634 |
| Molecular Formula | C48H62BN |
| Molecular Weight | 663.84 g/mol |
| Exact Mass | 663.50 |
| IUPAC Name | diheptyl-methyl-(2-phenylprop-2-enyl)azanium;tetraphenylboranuide |
| SMILES | C=C(C[N+](C)(CCCCCCC)CCCCCCC)c1ccccc1.c1ccc([B-](c2ccccc2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C24H20B.C24H42N/c1-5-13-21(14-6-1)25(22-15-7-2-8-16-22,23-17-9-3-10-18-23)24-19-11-4-12-20-24;1-5-7-9-11-16-20-25(4,21-17-12-10-8-6-2)22-23(3)24-18-14-13-15-19-24/h1-20H;13-15,18-19H,3,5-12,16-17,20-22H2,1-2,4H3/q-1;+1 |
| InChIKey | UDCCDRIIRPVANW-UHFFFAOYSA-N |
| XLogP | 10.15 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 19 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.84 |
| LogP ≤ 5 | 10.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|