C12H19NaO5S — CID 173139636
sodium;hydride;4-(6-hydroxyhexoxy)benzenesulfonic acid (PubChem CID 173139636) has the molecular formula C12H19NaO5S and a molecular weight of 298.34 g/mol. Its IUPAC name is sodium;hydride;4-(6-hydroxyhexoxy)benzenesulfonic acid.
| Compound Name | sodium;hydride;4-(6-hydroxyhexoxy)benzenesulfonic acid |
|---|---|
| PubChem CID | 173139636 |
| Molecular Formula | C12H19NaO5S |
| Molecular Weight | 298.34 g/mol |
| Exact Mass | 298.09 |
| IUPAC Name | sodium;hydride;4-(6-hydroxyhexoxy)benzenesulfonic acid |
| SMILES | O=S(=O)(O)c1ccc(OCCCCCCO)cc1.[H-].[Na+] |
| InChI | InChI=1S/C12H18O5S.Na.H/c13-9-3-1-2-4-10-17-11-5-7-12(8-6-11)18(14,15)16;;/h5-8,13H,1-4,9-10H2,(H,14,15,16);;/q;+1;-1 |
| InChIKey | BMVBAZYHTKONBX-UHFFFAOYSA-N |
| XLogP | -1.02 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.34 |
| LogP ≤ 5 | -1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|