C16H16O4S — CID 86126985
(4-methoxyphenyl)methyl 4-ethenylbenzenesulfonate (PubChem CID 86126985) has the molecular formula C16H16O4S and a molecular weight of 304.37 g/mol. Its IUPAC name is (4-methoxyphenyl)methyl 4-ethenylbenzenesulfonate.
| Compound Name | (4-methoxyphenyl)methyl 4-ethenylbenzenesulfonate |
|---|---|
| PubChem CID | 86126985 |
| Molecular Formula | C16H16O4S |
| Molecular Weight | 304.37 g/mol |
| Exact Mass | 304.08 |
| IUPAC Name | (4-methoxyphenyl)methyl 4-ethenylbenzenesulfonate |
| SMILES | C=Cc1ccc(S(=O)(=O)OCc2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C16H16O4S/c1-3-13-6-10-16(11-7-13)21(17,18)20-12-14-4-8-15(19-2)9-5-14/h3-11H,1,12H2,2H3 |
| InChIKey | FGIGPKRIJUAUOI-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.37 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|