C15H10Cl4O3 — CID 139092302
1-ethenyl-4-methoxybenzene;3,4,5,6-tetrachlorocyclohexa-3,5-diene-1,2-dione (PubChem CID 139092302) has the molecular formula C15H10Cl4O3 and a molecular weight of 380.05 g/mol. Its IUPAC name is 1-ethenyl-4-methoxybenzene;3,4,5,6-tetrachlorocyclohexa-3,5-diene-1,2-dione.
| Compound Name | 1-ethenyl-4-methoxybenzene;3,4,5,6-tetrachlorocyclohexa-3,5-diene-1,2-dione |
|---|---|
| PubChem CID | 139092302 |
| Molecular Formula | C15H10Cl4O3 |
| Molecular Weight | 380.05 g/mol |
| Exact Mass | 377.94 |
| IUPAC Name | 1-ethenyl-4-methoxybenzene;3,4,5,6-tetrachlorocyclohexa-3,5-diene-1,2-dione |
| SMILES | C=Cc1ccc(OC)cc1.O=C1C(=O)C(Cl)=C(Cl)C(Cl)=C1Cl |
| InChI | InChI=1S/C9H10O.C6Cl4O2/c1-3-8-4-6-9(10-2)7-5-8;7-1-2(8)4(10)6(12)5(11)3(1)9/h3-7H,1H2,2H3; |
| InChIKey | CWRZWMNWMSFRNH-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.05 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|