C14H18O — CID 21495831
1-ethenyl-4-methoxybenzene;2-methylbuta-1,3-diene (PubChem CID 21495831) has the molecular formula C14H18O and a molecular weight of 202.30 g/mol. Its IUPAC name is 1-ethenyl-4-methoxybenzene;2-methylbuta-1,3-diene.
| Compound Name | 1-ethenyl-4-methoxybenzene;2-methylbuta-1,3-diene |
|---|---|
| PubChem CID | 21495831 |
| Molecular Formula | C14H18O |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.14 |
| IUPAC Name | 1-ethenyl-4-methoxybenzene;2-methylbuta-1,3-diene |
| SMILES | C=CC(=C)C.C=Cc1ccc(OC)cc1 |
| InChI | InChI=1S/C9H10O.C5H8/c1-3-8-4-6-9(10-2)7-5-8;1-4-5(2)3/h3-7H,1H2,2H3;4H,1-2H2,3H3 |
| InChIKey | HVNHNVZYDDWOHE-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|