C12H13N3O — CID 174412273
1-ethenyl-4-methoxybenzene;triazine (PubChem CID 174412273) has the molecular formula C12H13N3O and a molecular weight of 215.26 g/mol. Its IUPAC name is 1-ethenyl-4-methoxybenzene;triazine.
| Compound Name | 1-ethenyl-4-methoxybenzene;triazine |
|---|---|
| PubChem CID | 174412273 |
| Molecular Formula | C12H13N3O |
| Molecular Weight | 215.26 g/mol |
| Exact Mass | 215.11 |
| IUPAC Name | 1-ethenyl-4-methoxybenzene;triazine |
| SMILES | C=Cc1ccc(OC)cc1.c1cnnnc1 |
| InChI | InChI=1S/C9H10O.C3H3N3/c1-3-8-4-6-9(10-2)7-5-8;1-2-4-6-5-3-1/h3-7H,1H2,2H3;1-3H |
| InChIKey | JSAILIHDKJNTSF-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 47.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.26 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |