C43H37N3O2 — CID 155159230
3-N,6-N-bis(4-ethenylphenyl)-3-N,6-N-bis(4-methoxyphenyl)-9-methylcarbazole-3,6-diamine (PubChem CID 155159230) has the molecular formula C43H37N3O2 and a molecular weight of 627.79 g/mol. Its IUPAC name is 3-N,6-N-bis(4-ethenylphenyl)-3-N,6-N-bis(4-methoxyphenyl)-9-methylcarbazole-3,6-diamine.
| Compound Name | 3-N,6-N-bis(4-ethenylphenyl)-3-N,6-N-bis(4-methoxyphenyl)-9-methylcarbazole-3,6-diamine |
|---|---|
| PubChem CID | 155159230 |
| Molecular Formula | C43H37N3O2 |
| Molecular Weight | 627.79 g/mol |
| Exact Mass | 627.29 |
| IUPAC Name | 3-N,6-N-bis(4-ethenylphenyl)-3-N,6-N-bis(4-methoxyphenyl)-9-methylcarbazole-3,6-diamine |
| SMILES | C=Cc1ccc(N(c2ccc(OC)cc2)c2ccc3c(c2)c2cc(N(c4ccc(C=C)cc4)c4ccc(OC)cc4)ccc2n3C)cc1 |
| InChI | InChI=1S/C43H37N3O2/c1-6-30-8-12-32(13-9-30)45(34-16-22-38(47-4)23-17-34)36-20-26-42-40(28-36)41-29-37(21-27-43(41)44(42)3)46(33-14-10-31(7-2)11-15-33)35-18-24-39(48-5)25-19-35/h6-29H,1-2H2,3-5H3 |
| InChIKey | SFYLIJZTNALYRT-UHFFFAOYSA-N |
| XLogP | 11.57 |
| TPSA | 29.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.79 |
| LogP ≤ 5 | 11.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |