C23H22O3 — CID 101342310
(4-ethenylphenyl)-bis(4-methoxyphenyl)methanol (PubChem CID 101342310) has the molecular formula C23H22O3 and a molecular weight of 346.43 g/mol. Its IUPAC name is (4-ethenylphenyl)-bis(4-methoxyphenyl)methanol.
| Compound Name | (4-ethenylphenyl)-bis(4-methoxyphenyl)methanol |
|---|---|
| PubChem CID | 101342310 |
| Molecular Formula | C23H22O3 |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.16 |
| IUPAC Name | (4-ethenylphenyl)-bis(4-methoxyphenyl)methanol |
| SMILES | C=Cc1ccc(C(O)(c2ccc(OC)cc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C23H22O3/c1-4-17-5-7-18(8-6-17)23(24,19-9-13-21(25-2)14-10-19)20-11-15-22(26-3)16-12-20/h4-16,24H,1H2,2-3H3 |
| InChIKey | YNBGWYMCHUIPNO-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|