C31H25N3O2 — CID 59439786
2-[4-(4-ethenylphenyl)phenyl]-4,6-bis(4-methoxyphenyl)-1,3,5-triazine (PubChem CID 59439786) has the molecular formula C31H25N3O2 and a molecular weight of 471.56 g/mol. Its IUPAC name is 2-[4-(4-ethenylphenyl)phenyl]-4,6-bis(4-methoxyphenyl)-1,3,5-triazine.
| Compound Name | 2-[4-(4-ethenylphenyl)phenyl]-4,6-bis(4-methoxyphenyl)-1,3,5-triazine |
|---|---|
| PubChem CID | 59439786 |
| Molecular Formula | C31H25N3O2 |
| Molecular Weight | 471.56 g/mol |
| Exact Mass | 471.19 |
| IUPAC Name | 2-[4-(4-ethenylphenyl)phenyl]-4,6-bis(4-methoxyphenyl)-1,3,5-triazine |
| SMILES | C=Cc1ccc(-c2ccc(-c3nc(-c4ccc(OC)cc4)nc(-c4ccc(OC)cc4)n3)cc2)cc1 |
| InChI | InChI=1S/C31H25N3O2/c1-4-21-5-7-22(8-6-21)23-9-11-24(12-10-23)29-32-30(25-13-17-27(35-2)18-14-25)34-31(33-29)26-15-19-28(36-3)20-16-26/h4-20H,1H2,2-3H3 |
| InChIKey | CSPJZQHZYCRZLS-UHFFFAOYSA-N |
| XLogP | 7.20 |
| TPSA | 57.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.56 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |