C53H61N7O6 — CID 101054146
[4-[6-[[4-(4-ethenylphenyl)-6-[10-[4-[(4-methoxyphenyl)diazenyl]phenoxy]decoxy]-1,3,5-triazin-2-yl]oxy]hexoxy]phenyl]-(4-methoxyphenyl)diazene (PubChem CID 101054146) has the molecular formula C53H61N7O6 and a molecular weight of 892.11 g/mol. Its IUPAC name is [4-[6-[[4-(4-ethenylphenyl)-6-[10-[4-[(4-methoxyphenyl)diazenyl]phenoxy]decoxy]-1,3,5-triazin-2-yl]oxy]hexoxy]phenyl]-(4-methoxyphenyl)diazene.
| Compound Name | [4-[6-[[4-(4-ethenylphenyl)-6-[10-[4-[(4-methoxyphenyl)diazenyl]phenoxy]decoxy]-1,3,5-triazin-2-yl]oxy]hexoxy]phenyl]-(4-methoxyphenyl)diazene |
|---|---|
| PubChem CID | 101054146 |
| Molecular Formula | C53H61N7O6 |
| Molecular Weight | 892.11 g/mol |
| Exact Mass | 891.47 |
| IUPAC Name | [4-[6-[[4-(4-ethenylphenyl)-6-[10-[4-[(4-methoxyphenyl)diazenyl]phenoxy]decoxy]-1,3,5-triazin-2-yl]oxy]hexoxy]phenyl]-(4-methoxyphenyl)diazene |
| SMILES | C=Cc1ccc(-c2nc(OCCCCCCCCCCOc3ccc(/N=N/c4ccc(OC)cc4)cc3)nc(OCCCCCCOc3ccc(/N=N/c4ccc(OC)cc4)cc3)n2)cc1 |
| InChI | InChI=1S/C53H61N7O6/c1-4-41-17-19-42(20-18-41)51-54-52(56-53(55-51)66-40-16-12-11-14-38-64-50-35-27-46(28-36-50)60-58-44-23-31-48(62-3)32-24-44)65-39-15-10-8-6-5-7-9-13-37-63-49-33-25-45(26-34-49)59-57-43-21-29-47(61-2)30-22-43/h4,17-36H,1,5-16,37-40H2,2-3H3/b59-57+,60-58+ |
| InChIKey | FKCCFKBVCCSVMX-YGZNCWGHSA-N |
| XLogP | 14.63 |
| TPSA | 143.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 66 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 892.11 |
| LogP ≤ 5 | 14.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|