C18H26 — CID 159294849
1-ethenyl-4-methylbenzene;2-methylbuta-1,3-diene;2-methylprop-1-ene (PubChem CID 159294849) has the molecular formula C18H26 and a molecular weight of 242.41 g/mol. Its IUPAC name is 1-ethenyl-4-methylbenzene;2-methylbuta-1,3-diene;2-methylprop-1-ene.
| Compound Name | 1-ethenyl-4-methylbenzene;2-methylbuta-1,3-diene;2-methylprop-1-ene |
|---|---|
| PubChem CID | 159294849 |
| Molecular Formula | C18H26 |
| Molecular Weight | 242.41 g/mol |
| Exact Mass | 242.20 |
| IUPAC Name | 1-ethenyl-4-methylbenzene;2-methylbuta-1,3-diene;2-methylprop-1-ene |
| SMILES | C=C(C)C.C=CC(=C)C.C=Cc1ccc(C)cc1 |
| InChI | InChI=1S/C9H10.C5H8.C4H8/c1-3-9-6-4-8(2)5-7-9;1-4-5(2)3;1-4(2)3/h3-7H,1H2,2H3;4H,1-2H2,3H3;1H2,2-3H3 |
| InChIKey | LAOUNGYUCAGCIL-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.41 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|