About methane;2-methylbuta-1,3-diene;1,4-xylene
methane;2-methylbuta-1,3-diene;1,4-xylene (PubChem CID 145089492) has the molecular formula C14H22
and a molecular weight of 190.33 g/mol. Its IUPAC name is methane;2-methylbuta-1,3-diene;1,4-xylene.
Molecular Properties
| Compound Name | methane;2-methylbuta-1,3-diene;1,4-xylene |
| PubChem CID | 145089492 |
| Molecular Formula | C14H22 |
| Molecular Weight | 190.33 g/mol |
| Exact Mass | 190.17 |
| IUPAC Name | methane;2-methylbuta-1,3-diene;1,4-xylene |
| SMILES | C.C=CC(=C)C.Cc1ccc(C)cc1 |
| InChI | InChI=1S/C8H10.C5H8.CH4/c1-7-3-5-8(2)6-4-7;1-4-5(2)3;/h3-6H,1-2H3;4H,1-2H2,3H3;1H4 |
| InChIKey | SWXCQTLVFXIQDS-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.33 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze methane;2-methylbuta-1,3-diene;1,4-xylene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methane;2-methylbuta-1,3-diene;1,4-xylene?
The IUPAC name of methane;2-methylbuta-1,3-diene;1,4-xylene (CID 145089492) is methane;2-methylbuta-1,3-diene;1,4-xylene.
What is the SMILES notation for methane;2-methylbuta-1,3-diene;1,4-xylene?
The canonical SMILES for methane;2-methylbuta-1,3-diene;1,4-xylene is C.C=CC(=C)C.Cc1ccc(C)cc1.
What is the InChIKey of methane;2-methylbuta-1,3-diene;1,4-xylene?
The InChIKey is SWXCQTLVFXIQDS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10.C5H8.CH4/c1-7-3-5-8(2)6-4-7;1-4-5(2)3;/h3-6H,1-2H3;4H,1-2H2,3H3;1H4.
What are the key properties of methane;2-methylbuta-1,3-diene;1,4-xylene?
methane;2-methylbuta-1,3-diene;1,4-xylene has a molecular weight of 190.33 g/mol, XLogP of 4.69, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for methane;2-methylbuta-1,3-diene;1,4-xylene is sourced from PubChem (CID 145089492), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).