C14H22 — CID 145089492
methane;2-methylbuta-1,3-diene;1,4-xylene (PubChem CID 145089492) has the molecular formula C14H22 and a molecular weight of 190.33 g/mol. Its IUPAC name is methane;2-methylbuta-1,3-diene;1,4-xylene.
| Compound Name | methane;2-methylbuta-1,3-diene;1,4-xylene |
|---|---|
| PubChem CID | 145089492 |
| Molecular Formula | C14H22 |
| Molecular Weight | 190.33 g/mol |
| Exact Mass | 190.17 |
| IUPAC Name | methane;2-methylbuta-1,3-diene;1,4-xylene |
| SMILES | C.C=CC(=C)C.Cc1ccc(C)cc1 |
| InChI | InChI=1S/C8H10.C5H8.CH4/c1-7-3-5-8(2)6-4-7;1-4-5(2)3;/h3-6H,1-2H3;4H,1-2H2,3H3;1H4 |
| InChIKey | SWXCQTLVFXIQDS-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.33 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|