C15H21N — CID 143627211
(3Z)-2,4-dimethylhexa-1,3,5-triene;4-methylaniline (PubChem CID 143627211) has the molecular formula C15H21N and a molecular weight of 215.34 g/mol. Its IUPAC name is (3Z)-2,4-dimethylhexa-1,3,5-triene;4-methylaniline.
| Compound Name | (3Z)-2,4-dimethylhexa-1,3,5-triene;4-methylaniline |
|---|---|
| PubChem CID | 143627211 |
| Molecular Formula | C15H21N |
| Molecular Weight | 215.34 g/mol |
| Exact Mass | 215.17 |
| IUPAC Name | (3Z)-2,4-dimethylhexa-1,3,5-triene;4-methylaniline |
| SMILES | C=C/C(C)=C\C(=C)C.Cc1ccc(N)cc1 |
| InChI | InChI=1S/C8H12.C7H9N/c1-5-8(4)6-7(2)3;1-6-2-4-7(8)5-3-6/h5-6H,1-2H2,3-4H3;2-5H,8H2,1H3/b8-6-; |
| InChIKey | OFYNUKDHSWVQGO-PHZXCRFESA-N |
| XLogP | 4.27 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.34 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|