About 4-methylaniline;sulfur trioxide
4-methylaniline;sulfur trioxide (PubChem CID 158922912) has the molecular formula C7H9NO3S
and a molecular weight of 187.22 g/mol. Its IUPAC name is 4-methylaniline;sulfur trioxide.
Molecular Properties
| Compound Name | 4-methylaniline;sulfur trioxide |
| PubChem CID | 158922912 |
| Molecular Formula | C7H9NO3S |
| Molecular Weight | 187.22 g/mol |
| Exact Mass | 187.03 |
| IUPAC Name | 4-methylaniline;sulfur trioxide |
| SMILES | Cc1ccc(N)cc1.O=S(=O)=O |
| InChI | InChI=1S/C7H9N.O3S/c1-6-2-4-7(8)5-3-6;1-4(2)3/h2-5H,8H2,1H3; |
| InChIKey | JIBJCUVYLOOFAM-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 77.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.22 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-methylaniline;sulfur trioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methylaniline;sulfur trioxide?
The IUPAC name of 4-methylaniline;sulfur trioxide (CID 158922912) is 4-methylaniline;sulfur trioxide.
What is the SMILES notation for 4-methylaniline;sulfur trioxide?
The canonical SMILES for 4-methylaniline;sulfur trioxide is Cc1ccc(N)cc1.O=S(=O)=O.
What is the InChIKey of 4-methylaniline;sulfur trioxide?
The InChIKey is JIBJCUVYLOOFAM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9N.O3S/c1-6-2-4-7(8)5-3-6;1-4(2)3/h2-5H,8H2,1H3;.
What are the key properties of 4-methylaniline;sulfur trioxide?
4-methylaniline;sulfur trioxide has a molecular weight of 187.22 g/mol, XLogP of 0.57, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methylaniline;sulfur trioxide is sourced from PubChem (CID 158922912), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).