C15H16 — CID 159864264
2-methylbuta-1,3-diene;naphthalene (PubChem CID 159864264) has the molecular formula C15H16 and a molecular weight of 196.29 g/mol. Its IUPAC name is 2-methylbuta-1,3-diene;naphthalene.
| Compound Name | 2-methylbuta-1,3-diene;naphthalene |
|---|---|
| PubChem CID | 159864264 |
| Molecular Formula | C15H16 |
| Molecular Weight | 196.29 g/mol |
| Exact Mass | 196.13 |
| IUPAC Name | 2-methylbuta-1,3-diene;naphthalene |
| SMILES | C=CC(=C)C.c1ccc2ccccc2c1 |
| InChI | InChI=1S/C10H8.C5H8/c1-2-6-10-8-4-3-7-9(10)5-1;1-4-5(2)3/h1-8H;4H,1-2H2,3H3 |
| InChIKey | NRNNVTPHALZDGM-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.29 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|