C13H20 — CID 161391360
bis(buta-1,3-diene);2-methylbuta-1,3-diene (PubChem CID 161391360) has the molecular formula C13H20 and a molecular weight of 176.30 g/mol. Its IUPAC name is bis(buta-1,3-diene);2-methylbuta-1,3-diene.
| Compound Name | bis(buta-1,3-diene);2-methylbuta-1,3-diene |
|---|---|
| PubChem CID | 161391360 |
| Molecular Formula | C13H20 |
| Molecular Weight | 176.30 g/mol |
| Exact Mass | 176.16 |
| IUPAC Name | bis(buta-1,3-diene);2-methylbuta-1,3-diene |
| SMILES | C=CC(=C)C.C=CC=C.C=CC=C |
| InChI | InChI=1S/C5H8.2C4H6/c1-4-5(2)3;2*1-3-4-2/h4H,1-2H2,3H3;2*3-4H,1-2H2 |
| InChIKey | VTAKCMKFIQXIMS-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.30 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|