About 2-methylbuta-1,3-diene;2-methylpropane
2-methylbuta-1,3-diene;2-methylpropane (PubChem CID 19064095) has the molecular formula C9H18
and a molecular weight of 126.24 g/mol. Its IUPAC name is 2-methylbuta-1,3-diene;2-methylpropane.
Molecular Properties
| Compound Name | 2-methylbuta-1,3-diene;2-methylpropane |
| PubChem CID | 19064095 |
| Molecular Formula | C9H18 |
| Molecular Weight | 126.24 g/mol |
| Exact Mass | 126.14 |
| IUPAC Name | 2-methylbuta-1,3-diene;2-methylpropane |
| SMILES | C=CC(=C)C.CC(C)C |
| InChI | InChI=1S/C5H8.C4H10/c1-4-5(2)3;1-4(2)3/h4H,1-2H2,3H3;4H,1-3H3 |
| InChIKey | JSIDFYFRQGOWFS-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 126.24 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 2-methylbuta-1,3-diene;2-methylpropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylbuta-1,3-diene;2-methylpropane?
The IUPAC name of 2-methylbuta-1,3-diene;2-methylpropane (CID 19064095) is 2-methylbuta-1,3-diene;2-methylpropane.
What is the SMILES notation for 2-methylbuta-1,3-diene;2-methylpropane?
The canonical SMILES for 2-methylbuta-1,3-diene;2-methylpropane is C=CC(=C)C.CC(C)C.
What is the InChIKey of 2-methylbuta-1,3-diene;2-methylpropane?
The InChIKey is JSIDFYFRQGOWFS-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8.C4H10/c1-4-5(2)3;1-4(2)3/h4H,1-2H2,3H3;4H,1-3H3.
What are the key properties of 2-methylbuta-1,3-diene;2-methylpropane?
2-methylbuta-1,3-diene;2-methylpropane has a molecular weight of 126.24 g/mol, XLogP of 3.41, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylbuta-1,3-diene;2-methylpropane is sourced from PubChem (CID 19064095), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).