C7H12O3S — CID 162209988
ethenesulfonic acid;2-methylbuta-1,3-diene (PubChem CID 162209988) has the molecular formula C7H12O3S and a molecular weight of 176.24 g/mol. Its IUPAC name is ethenesulfonic acid;2-methylbuta-1,3-diene.
| Compound Name | ethenesulfonic acid;2-methylbuta-1,3-diene |
|---|---|
| PubChem CID | 162209988 |
| Molecular Formula | C7H12O3S |
| Molecular Weight | 176.24 g/mol |
| Exact Mass | 176.05 |
| IUPAC Name | ethenesulfonic acid;2-methylbuta-1,3-diene |
| SMILES | C=CC(=C)C.C=CS(=O)(=O)O |
| InChI | InChI=1S/C5H8.C2H4O3S/c1-4-5(2)3;1-2-6(3,4)5/h4H,1-2H2,3H3;2H,1H2,(H,3,4,5) |
| InChIKey | ZSSGVZGJSYWFOF-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.24 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|