C8H14O8S2 — CID 19833290
ethenesulfonic acid;1-(2-methylprop-2-enoyloxy)ethanesulfonic acid (PubChem CID 19833290) has the molecular formula C8H14O8S2 and a molecular weight of 302.33 g/mol. Its IUPAC name is ethenesulfonic acid;1-(2-methylprop-2-enoyloxy)ethanesulfonic acid.
| Compound Name | ethenesulfonic acid;1-(2-methylprop-2-enoyloxy)ethanesulfonic acid |
|---|---|
| PubChem CID | 19833290 |
| Molecular Formula | C8H14O8S2 |
| Molecular Weight | 302.33 g/mol |
| Exact Mass | 302.01 |
| IUPAC Name | ethenesulfonic acid;1-(2-methylprop-2-enoyloxy)ethanesulfonic acid |
| SMILES | C=C(C)C(=O)OC(C)S(=O)(=O)O.C=CS(=O)(=O)O |
| InChI | InChI=1S/C6H10O5S.C2H4O3S/c1-4(2)6(7)11-5(3)12(8,9)10;1-2-6(3,4)5/h5H,1H2,2-3H3,(H,8,9,10);2H,1H2,(H,3,4,5) |
| InChIKey | TXJRBJHFQFWOSD-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 135.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.33 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|