About ethenylsulfonyl 2-methylprop-2-enoate
ethenylsulfonyl 2-methylprop-2-enoate (PubChem CID 87143223) has the molecular formula C6H8O4S
and a molecular weight of 176.19 g/mol. Its IUPAC name is ethenylsulfonyl 2-methylprop-2-enoate.
Molecular Properties
| Compound Name | ethenylsulfonyl 2-methylprop-2-enoate |
| PubChem CID | 87143223 |
| Molecular Formula | C6H8O4S |
| Molecular Weight | 176.19 g/mol |
| Exact Mass | 176.01 |
| IUPAC Name | ethenylsulfonyl 2-methylprop-2-enoate |
| SMILES | C=CS(=O)(=O)OC(=O)C(=C)C |
| InChI | InChI=1S/C6H8O4S/c1-4-11(8,9)10-6(7)5(2)3/h4H,1-2H2,3H3 |
| InChIKey | JVTKAWJRRMIORH-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.19 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze ethenylsulfonyl 2-methylprop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethenylsulfonyl 2-methylprop-2-enoate?
The IUPAC name of ethenylsulfonyl 2-methylprop-2-enoate (CID 87143223) is ethenylsulfonyl 2-methylprop-2-enoate.
What is the SMILES notation for ethenylsulfonyl 2-methylprop-2-enoate?
The canonical SMILES for ethenylsulfonyl 2-methylprop-2-enoate is C=CS(=O)(=O)OC(=O)C(=C)C.
What is the InChIKey of ethenylsulfonyl 2-methylprop-2-enoate?
The InChIKey is JVTKAWJRRMIORH-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8O4S/c1-4-11(8,9)10-6(7)5(2)3/h4H,1-2H2,3H3.
What are the key properties of ethenylsulfonyl 2-methylprop-2-enoate?
ethenylsulfonyl 2-methylprop-2-enoate has a molecular weight of 176.19 g/mol, XLogP of 0.58, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethenylsulfonyl 2-methylprop-2-enoate is sourced from PubChem (CID 87143223), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).