C7H10O5S — CID 87647233
1-(2-methylprop-2-enoyloxy)prop-2-ene-1-sulfonic acid (PubChem CID 87647233) has the molecular formula C7H10O5S and a molecular weight of 206.22 g/mol. Its IUPAC name is 1-(2-methylprop-2-enoyloxy)prop-2-ene-1-sulfonic acid.
| Compound Name | 1-(2-methylprop-2-enoyloxy)prop-2-ene-1-sulfonic acid |
|---|---|
| PubChem CID | 87647233 |
| Molecular Formula | C7H10O5S |
| Molecular Weight | 206.22 g/mol |
| Exact Mass | 206.02 |
| IUPAC Name | 1-(2-methylprop-2-enoyloxy)prop-2-ene-1-sulfonic acid |
| SMILES | C=CC(OC(=O)C(=C)C)S(=O)(=O)O |
| InChI | InChI=1S/C7H10O5S/c1-4-6(13(9,10)11)12-7(8)5(2)3/h4,6H,1-2H2,3H3,(H,9,10,11) |
| InChIKey | ZEHKWCUQJVADJF-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.22 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|