C10H22NO5S+ — CID 174446040
methanesulfonic acid;trimethyl-[1-(2-methylprop-2-enoyloxy)ethyl]azanium (PubChem CID 174446040) has the molecular formula C10H22NO5S+ and a molecular weight of 268.35 g/mol. Its IUPAC name is methanesulfonic acid;trimethyl-[1-(2-methylprop-2-enoyloxy)ethyl]azanium.
| Compound Name | methanesulfonic acid;trimethyl-[1-(2-methylprop-2-enoyloxy)ethyl]azanium |
|---|---|
| PubChem CID | 174446040 |
| Molecular Formula | C10H22NO5S+ |
| Molecular Weight | 268.35 g/mol |
| Exact Mass | 268.12 |
| IUPAC Name | methanesulfonic acid;trimethyl-[1-(2-methylprop-2-enoyloxy)ethyl]azanium |
| SMILES | C=C(C)C(=O)OC(C)[N+](C)(C)C.CS(=O)(=O)O |
| InChI | InChI=1S/C9H18NO2.CH4O3S/c1-7(2)9(11)12-8(3)10(4,5)6;1-5(2,3)4/h8H,1H2,2-6H3;1H3,(H,2,3,4)/q+1; |
| InChIKey | FFIGBFYNFXYSMV-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.35 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|