C12H25NO2 — CID 140517255
ethane;ethyl-dimethyl-[1-(2-methylprop-2-enoyloxy)ethyl]azanium (PubChem CID 140517255) has the molecular formula C12H25NO2 and a molecular weight of 215.34 g/mol. Its IUPAC name is ethane;ethyl-dimethyl-[1-(2-methylprop-2-enoyloxy)ethyl]azanium.
| Compound Name | ethane;ethyl-dimethyl-[1-(2-methylprop-2-enoyloxy)ethyl]azanium |
|---|---|
| PubChem CID | 140517255 |
| Molecular Formula | C12H25NO2 |
| Molecular Weight | 215.34 g/mol |
| Exact Mass | 215.19 |
| IUPAC Name | ethane;ethyl-dimethyl-[1-(2-methylprop-2-enoyloxy)ethyl]azanium |
| SMILES | C=C(C)C(=O)OC(C)[N+](C)(C)CC.[CH2-]C |
| InChI | InChI=1S/C10H20NO2.C2H5/c1-7-11(5,6)9(4)13-10(12)8(2)3;1-2/h9H,2,7H2,1,3-6H3;1H2,2H3/q+1;-1 |
| InChIKey | JQIQHNSDCLTSSY-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.34 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|