About 1-aminoprop-2-enyl 2-methylprop-2-enoate;hydrochloride
1-aminoprop-2-enyl 2-methylprop-2-enoate;hydrochloride (PubChem CID 87215284) has the molecular formula C7H12ClNO2
and a molecular weight of 177.63 g/mol. Its IUPAC name is 1-aminoprop-2-enyl 2-methylprop-2-enoate;hydrochloride.
Molecular Properties
| Compound Name | 1-aminoprop-2-enyl 2-methylprop-2-enoate;hydrochloride |
| PubChem CID | 87215284 |
| Molecular Formula | C7H12ClNO2 |
| Molecular Weight | 177.63 g/mol |
| Exact Mass | 177.06 |
| IUPAC Name | 1-aminoprop-2-enyl 2-methylprop-2-enoate;hydrochloride |
| SMILES | C=CC(N)OC(=O)C(=C)C.Cl |
| InChI | InChI=1S/C7H11NO2.ClH/c1-4-6(8)10-7(9)5(2)3;/h4,6H,1-2,8H2,3H3;1H |
| InChIKey | DPDPQXBXNMZOTR-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.63 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 1-aminoprop-2-enyl 2-methylprop-2-enoate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-aminoprop-2-enyl 2-methylprop-2-enoate;hydrochloride?
The IUPAC name of 1-aminoprop-2-enyl 2-methylprop-2-enoate;hydrochloride (CID 87215284) is 1-aminoprop-2-enyl 2-methylprop-2-enoate;hydrochloride.
What is the SMILES notation for 1-aminoprop-2-enyl 2-methylprop-2-enoate;hydrochloride?
The canonical SMILES for 1-aminoprop-2-enyl 2-methylprop-2-enoate;hydrochloride is C=CC(N)OC(=O)C(=C)C.Cl.
What is the InChIKey of 1-aminoprop-2-enyl 2-methylprop-2-enoate;hydrochloride?
The InChIKey is DPDPQXBXNMZOTR-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11NO2.ClH/c1-4-6(8)10-7(9)5(2)3;/h4,6H,1-2,8H2,3H3;1H.
What are the key properties of 1-aminoprop-2-enyl 2-methylprop-2-enoate;hydrochloride?
1-aminoprop-2-enyl 2-methylprop-2-enoate;hydrochloride has a molecular weight of 177.63 g/mol, XLogP of 1.00, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-aminoprop-2-enyl 2-methylprop-2-enoate;hydrochloride is sourced from PubChem (CID 87215284), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).