C10H17NO4 — CID 174390329
1-aminoethyl 2-methylprop-2-enoate;2-methylprop-2-enoic acid (PubChem CID 174390329) has the molecular formula C10H17NO4 and a molecular weight of 215.25 g/mol. Its IUPAC name is 1-aminoethyl 2-methylprop-2-enoate;2-methylprop-2-enoic acid.
| Compound Name | 1-aminoethyl 2-methylprop-2-enoate;2-methylprop-2-enoic acid |
|---|---|
| PubChem CID | 174390329 |
| Molecular Formula | C10H17NO4 |
| Molecular Weight | 215.25 g/mol |
| Exact Mass | 215.12 |
| IUPAC Name | 1-aminoethyl 2-methylprop-2-enoate;2-methylprop-2-enoic acid |
| SMILES | C=C(C)C(=O)O.C=C(C)C(=O)OC(C)N |
| InChI | InChI=1S/C6H11NO2.C4H6O2/c1-4(2)6(8)9-5(3)7;1-3(2)4(5)6/h5H,1,7H2,2-3H3;1H2,2H3,(H,5,6) |
| InChIKey | KGZPAULAGHHJRY-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 89.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.25 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|