About 1-isocyanatoethyl 2-methylprop-2-enoate;2-methylprop-2-enoic acid
1-isocyanatoethyl 2-methylprop-2-enoate;2-methylprop-2-enoic acid (PubChem CID 174742154) has the molecular formula C11H15NO5
and a molecular weight of 241.24 g/mol. Its IUPAC name is 1-isocyanatoethyl 2-methylprop-2-enoate;2-methylprop-2-enoic acid.
Molecular Properties
| Compound Name | 1-isocyanatoethyl 2-methylprop-2-enoate;2-methylprop-2-enoic acid |
| PubChem CID | 174742154 |
| Molecular Formula | C11H15NO5 |
| Molecular Weight | 241.24 g/mol |
| Exact Mass | 241.10 |
| IUPAC Name | 1-isocyanatoethyl 2-methylprop-2-enoate;2-methylprop-2-enoic acid |
| SMILES | C=C(C)C(=O)O.C=C(C)C(=O)OC(C)N=C=O |
| InChI | InChI=1S/C7H9NO3.C4H6O2/c1-5(2)7(10)11-6(3)8-4-9;1-3(2)4(5)6/h6H,1H2,2-3H3;1H2,2H3,(H,5,6) |
| InChIKey | ORSPYNDLLRBEHQ-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 93.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.24 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 1-isocyanatoethyl 2-methylprop-2-enoate;2-methylprop-2-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-isocyanatoethyl 2-methylprop-2-enoate;2-methylprop-2-enoic acid?
The IUPAC name of 1-isocyanatoethyl 2-methylprop-2-enoate;2-methylprop-2-enoic acid (CID 174742154) is 1-isocyanatoethyl 2-methylprop-2-enoate;2-methylprop-2-enoic acid.
What is the SMILES notation for 1-isocyanatoethyl 2-methylprop-2-enoate;2-methylprop-2-enoic acid?
The canonical SMILES for 1-isocyanatoethyl 2-methylprop-2-enoate;2-methylprop-2-enoic acid is C=C(C)C(=O)O.C=C(C)C(=O)OC(C)N=C=O.
What is the InChIKey of 1-isocyanatoethyl 2-methylprop-2-enoate;2-methylprop-2-enoic acid?
The InChIKey is ORSPYNDLLRBEHQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9NO3.C4H6O2/c1-5(2)7(10)11-6(3)8-4-9;1-3(2)4(5)6/h6H,1H2,2-3H3;1H2,2H3,(H,5,6).
What are the key properties of 1-isocyanatoethyl 2-methylprop-2-enoate;2-methylprop-2-enoic acid?
1-isocyanatoethyl 2-methylprop-2-enoate;2-methylprop-2-enoic acid has a molecular weight of 241.24 g/mol, XLogP of 1.43, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-isocyanatoethyl 2-methylprop-2-enoate;2-methylprop-2-enoic acid is sourced from PubChem (CID 174742154), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).