methanol;2-(2-methylprop-2-enoyloxy)propanoic acid

C8H14O5 — CID 174868597

IUPACmethanol;2-(2-methylprop-2-enoyloxy)propanoic acid
SMILESC=C(C)C(=O)OC(C)C(=O)O.CO
InChIInChI=1S/C7H10O4.CH4O/c1-4(2)7(10)11-5(3)6(8)9;1-2/h5H,1H2,2-3H3,(H,8,9);2H,1H3
InChIKeyONJSLKIXRVBXQI-UHFFFAOYSA-N
MW190.19 g/mol
LogP0.19
Rot. Bonds3

About methanol;2-(2-methylprop-2-enoyloxy)propanoic acid

methanol;2-(2-methylprop-2-enoyloxy)propanoic acid (PubChem CID 174868597) has the molecular formula C8H14O5 and a molecular weight of 190.19 g/mol. Its IUPAC name is methanol;2-(2-methylprop-2-enoyloxy)propanoic acid.

Molecular Properties

Compound Namemethanol;2-(2-methylprop-2-enoyloxy)propanoic acid
PubChem CID174868597
Molecular FormulaC8H14O5
Molecular Weight190.19 g/mol
Exact Mass190.08
IUPAC Namemethanol;2-(2-methylprop-2-enoyloxy)propanoic acid
SMILESC=C(C)C(=O)OC(C)C(=O)O.CO
InChIInChI=1S/C7H10O4.CH4O/c1-4(2)7(10)11-5(3)6(8)9;1-2/h5H,1H2,2-3H3,(H,8,9);2H,1H3
InChIKeyONJSLKIXRVBXQI-UHFFFAOYSA-N
XLogP0.19
TPSA83.83 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500190.19
LogP ≤ 50.19
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze methanol;2-(2-methylprop-2-enoyloxy)propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methanol;2-(2-methylprop-2-enoyloxy)propanoic acid?
The IUPAC name of methanol;2-(2-methylprop-2-enoyloxy)propanoic acid (CID 174868597) is methanol;2-(2-methylprop-2-enoyloxy)propanoic acid.
What is the SMILES notation for methanol;2-(2-methylprop-2-enoyloxy)propanoic acid?
The canonical SMILES for methanol;2-(2-methylprop-2-enoyloxy)propanoic acid is C=C(C)C(=O)OC(C)C(=O)O.CO.
What is the InChIKey of methanol;2-(2-methylprop-2-enoyloxy)propanoic acid?
The InChIKey is ONJSLKIXRVBXQI-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10O4.CH4O/c1-4(2)7(10)11-5(3)6(8)9;1-2/h5H,1H2,2-3H3,(H,8,9);2H,1H3.
What are the key properties of methanol;2-(2-methylprop-2-enoyloxy)propanoic acid?
methanol;2-(2-methylprop-2-enoyloxy)propanoic acid has a molecular weight of 190.19 g/mol, XLogP of 0.19, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methanol;2-(2-methylprop-2-enoyloxy)propanoic acid is sourced from PubChem (CID 174868597), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).