C19H34O6Si — CID 160722442
2-methylprop-2-enoic acid;propan-2-yl 2-methylprop-2-enoate;trimethylsilylmethyl 2-methylprop-2-enoate (PubChem CID 160722442) has the molecular formula C19H34O6Si and a molecular weight of 386.56 g/mol. Its IUPAC name is 2-methylprop-2-enoic acid;propan-2-yl 2-methylprop-2-enoate;trimethylsilylmethyl 2-methylprop-2-enoate.
| Compound Name | 2-methylprop-2-enoic acid;propan-2-yl 2-methylprop-2-enoate;trimethylsilylmethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 160722442 |
| Molecular Formula | C19H34O6Si |
| Molecular Weight | 386.56 g/mol |
| Exact Mass | 386.21 |
| IUPAC Name | 2-methylprop-2-enoic acid;propan-2-yl 2-methylprop-2-enoate;trimethylsilylmethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)O.C=C(C)C(=O)OC(C)C.C=C(C)C(=O)OC[Si](C)(C)C |
| InChI | InChI=1S/C8H16O2Si.C7H12O2.C4H6O2/c1-7(2)8(9)10-6-11(3,4)5;1-5(2)7(8)9-6(3)4;1-3(2)4(5)6/h1,6H2,2-5H3;6H,1H2,2-4H3;1H2,2H3,(H,5,6) |
| InChIKey | RTGUOZLHDZCSRN-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.56 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|