C21H32O4Si — CID 86753510
2-phenylpropan-2-yl 2-methylprop-2-enoate;trimethylsilylmethyl 2-methylprop-2-enoate (PubChem CID 86753510) has the molecular formula C21H32O4Si and a molecular weight of 376.57 g/mol. Its IUPAC name is 2-phenylpropan-2-yl 2-methylprop-2-enoate;trimethylsilylmethyl 2-methylprop-2-enoate.
| Compound Name | 2-phenylpropan-2-yl 2-methylprop-2-enoate;trimethylsilylmethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 86753510 |
| Molecular Formula | C21H32O4Si |
| Molecular Weight | 376.57 g/mol |
| Exact Mass | 376.21 |
| IUPAC Name | 2-phenylpropan-2-yl 2-methylprop-2-enoate;trimethylsilylmethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC(C)(C)c1ccccc1.C=C(C)C(=O)OC[Si](C)(C)C |
| InChI | InChI=1S/C13H16O2.C8H16O2Si/c1-10(2)12(14)15-13(3,4)11-8-6-5-7-9-11;1-7(2)8(9)10-6-11(3,4)5/h5-9H,1H2,2-4H3;1,6H2,2-5H3 |
| InChIKey | CLYPIDOZJMPLPT-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.57 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|